Introduction：Basic information about CAS 510-22-5|Voacangine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Voacangine |
|---|
| CAS Number | 510-22-5 | Molecular Weight | 368.46900 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 518.4ºC at 760mmHg |
|---|
| Molecular Formula | C22H28N2O3 | Melting Point | 223-224ºC (dec.) |
|---|
| MSDS | / | Flash Point | 267.3ºC |
|---|
Names
| Name | Voacangine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 518.4ºC at 760mmHg |
|---|
| Melting Point | 223-224ºC (dec.) |
|---|
| Molecular Formula | C22H28N2O3 |
|---|
| Molecular Weight | 368.46900 |
|---|
| Flash Point | 267.3ºC |
|---|
| Exact Mass | 368.21000 |
|---|
| PSA | 54.56000 |
|---|
| LogP | 3.20170 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | MMAYTCMMKJYIAM-RUGRQLENSA-N |
|---|
| SMILES | CCC1CC2CN3CCc4c([nH]c5ccc(OC)cc45)C(C(=O)OC)(C2)C13 |
|---|
Synonyms
| methyl(2|A)-12-methoxyibogamine-18-carboxylate |
| Carbomethoxyibogaine |
| 12-methoxy-ibogamine-18-carboxylic acid methyl ester |
