Introduction：Basic information about CAS 15301-97-0|3-(3,5-dimethylphenyl)-4-hydroxychromen-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3,5-dimethylphenyl)-4-hydroxychromen-2-one |
|---|
| CAS Number | 15301-97-0 | Molecular Weight | 266.29100 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 416.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154ºC |
|---|
Names
| Name | 3-(3,5-dimethylphenyl)-4-hydroxychromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 416.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14O3 |
|---|
| Molecular Weight | 266.29100 |
|---|
| Flash Point | 154ºC |
|---|
| Exact Mass | 266.09400 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 3.78240 |
|---|
| Vapour Pressure | 1.11E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | MEGNNNHOKFVHGC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)cc(-c2c(O)c3ccccc3oc2=O)c1 |
|---|
Synonyms
| 3-(3,5-dimethyl-phenyl)-4-hydroxy-chromen-2-one |
| COUMARIN,3-(3,5-DIMETHYLPHENYL)-4-HYDROXY |
| 3-(3,5-Dimethylphenyl)-4-hydroxycoumarin |
| Xylocoumarol |
| Xylocoumarolum [INN-Latin] |
| Xylocumarolum |
| 3-(3,5-Dimethylphenyl)-4-hydroxy-cumarin |
| Xilocumarol [INN-Spanish] |
| 4-Hydroxy-3-(3,5-xylyl)coumarin |
| BS 7173-D |
