Introduction:Basic information about CAS 84697-21-2|Zinoconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zinoconazole |
|---|
| CAS Number | 84697-21-2 | Molecular Weight | 385.69900 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11Cl3N4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285ºC |
|---|
Names
| Name | 2,6-dichloro-N-[(E)-[1-(5-chlorothiophen-2-yl)-2-imidazol-1-ylethylidene]amino]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11Cl3N4S |
|---|
| Molecular Weight | 385.69900 |
|---|
| Flash Point | 285ºC |
|---|
| Exact Mass | 383.97700 |
|---|
| PSA | 70.45000 |
|---|
| LogP | 5.49420 |
|---|
| Index of Refraction | 1.698 |
|---|
| InChIKey | KCHHCAJDHQEGNL-UDWIEESQSA-N |
|---|
| SMILES | Clc1ccc(C(Cn2ccnc2)=NNc2c(Cl)cccc2Cl)s1 |
|---|
Synonyms
| Zinoconazole |
| Zinoconazole [INN] |
| (E)-1-(5-Chlorothien-2-yl)(1-H-imidazol-1-yl)ethanone 2,6-dichlorophenyhydrazone |
| UNII-J4562VG1V7 |