Introduction：Basic information about CAS 90243-66-6|Montirelin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Montirelin |
|---|
| CAS Number | 90243-66-6 | Molecular Weight | 408.47500 |
|---|
| Density | 1.398g/cm3 | Boiling Point | 994.2ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N6O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 555.1ºC |
|---|
Names
| Name | N-{[(3R,6R)-6-Methyl-5-oxo-3-thiomorpholinyl]carbonyl}-L-histidyl -L-prolinamide |
|---|
Chemical & Physical Properties
| Density | 1.398g/cm3 |
|---|
| Boiling Point | 994.2ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N6O4S |
|---|
| Molecular Weight | 408.47500 |
|---|
| Flash Point | 555.1ºC |
|---|
| Exact Mass | 408.15800 |
|---|
| PSA | 183.55000 |
|---|
| LogP | 0.73720 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | RSHMQGIMHQPMEB-IXOXFDKPSA-N |
|---|
| SMILES | CC1SCC(C(=O)NC(Cc2cnc[nH]2)C(=O)N2CCCC2C(N)=O)NC1=O |
|---|
