Introduction:Basic information about CAS 21149-38-2|bis(trimethylsilyl) sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(trimethylsilyl) sulfate |
|---|
| CAS Number | 21149-38-2 | Molecular Weight | 257.40100 |
|---|
| Density | 1.018 g/cm3 | Boiling Point | 87-90ºC4 mm Hg(lit.) |
|---|
| Molecular Formula | C8H18F3NOSi2 | Melting Point | 41-44ºC(lit.) |
|---|
| MSDS | / | Flash Point | 27 °F |
|---|
Names
| Name | bis(trimethylsilyl) sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.018 g/cm3 |
|---|
| Boiling Point | 87-90ºC4 mm Hg(lit.) |
|---|
| Melting Point | 41-44ºC(lit.) |
|---|
| Molecular Formula | C8H18F3NOSi2 |
|---|
| Molecular Weight | 257.40100 |
|---|
| Flash Point | 27 °F |
|---|
| Exact Mass | 257.08800 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 3.04710 |
|---|
| Vapour Pressure | 3.98mmHg at 25°C |
|---|
| Index of Refraction | 1.386 |
|---|
| InChIKey | RZYHXKLKJRGJGP-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)N(C(=O)C(F)(F)F)[Si](C)(C)C |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|
| Risk Phrases | R11 |
|---|
| Safety Phrases | 16-26-36/37/39-45 |
|---|
| RIDADR | UN 2925 4 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,2,2-trifluoro-n,n-bis(trimethylsilyl)-acetamid |
| n,n-bis(trimethylsilyl)-2,2,2-trifluoroacetamide |
| BIS(TRIMETHYLSILYL)SULPHATE |
| 2,2,2-trifluoro-N,N-bis(trimethylsilyl) ethanamide |
| bis-(trimethylsilyl)-trifluoroacetamide |
| bis-(N,N-trimethylsilyl)-trifluoroacetamide |
| N,N-BSTFA |
| trimethylsilyln-trimethylsilyltrifluoroacetimidate |
| 2,2,2-Trifluoro-N,N-bis(trimethylsilyl)acetamide |
| Bis(trimethylsilyl) trifluoroacetamide 98+ gas chromatography |
| Acetamide,2,2,2-trifluoro-N,N-bis(trimethylsilyl) |
| bis(trimethylsilyl)trifluoroacetoamide |
| N,N-bis(trimethylsilyl)-trifluoroacetamide |