Introduction:Basic information about CAS 871127-79-6|6-(3,5-difluorophenyl)-6-oxohexanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(3,5-difluorophenyl)-6-oxohexanoic acid |
|---|
| CAS Number | 871127-79-6 | Molecular Weight | 242.21900 |
|---|
| Density | 1.274g/cm3 | Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12F2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.7ºC |
|---|
Names
| Name | 6-(3,5-difluorophenyl)-6-oxohexanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.274g/cm3 |
|---|
| Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12F2O3 |
|---|
| Molecular Weight | 242.21900 |
|---|
| Flash Point | 190.7ºC |
|---|
| Exact Mass | 242.07500 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.79250 |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | GPRSZBJFIFKPIA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCCCC(=O)c1cc(F)cc(F)c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|