Introduction:Basic information about CAS 125926-53-6|1-[(4-Fluorophenyl)sulfonyl]-4-methylpiperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(4-Fluorophenyl)sulfonyl]-4-methylpiperazine |
|---|
| CAS Number | 125926-53-6 | Molecular Weight | 258.312 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 359.9±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15FN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.4±30.7 °C |
|---|
Names
| Name | 1-(4-fluorophenyl)sulfonyl-4-methylpiperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 359.9±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15FN2O2S |
|---|
| Molecular Weight | 258.312 |
|---|
| Flash Point | 171.4±30.7 °C |
|---|
| Exact Mass | 258.083832 |
|---|
| PSA | 49.00000 |
|---|
| LogP | 1.81 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | DSGBFQDACFDOAP-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
|---|
Synonyms
| Piperazine, 1-[(4-fluorophenyl)sulfonyl]-4-methyl- |
| 1-(4-Fluoro-benzenesulfonyl)-4-methyl-piperazine |
| 1-<(4-fluorophenyl)sulfonyl>-4-methylpiperazine |
| 1-[(4-Fluorophenyl)sulfonyl]-4-methylpiperazine |
| 1-((4-fluorophenyl)sulfonyl)-4-methylpiperazine |
| Piperazine,1-[(4-fluorophenyl)sulfonyl]-4-methyl |