Introduction:Basic information about CAS 1115-30-6|Ethyl acetylsuccinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl acetylsuccinate |
|---|
| CAS Number | 1115-30-6 | Molecular Weight | 216.231 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 255.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H16O5 | Melting Point | -8 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 126.1±21.8 °C |
|---|
Names
| Name | Diethyl acetylsuccinate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 255.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | -8 °C |
|---|
| Molecular Formula | C10H16O5 |
|---|
| Molecular Weight | 216.231 |
|---|
| Flash Point | 126.1±21.8 °C |
|---|
| Exact Mass | 216.099777 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.69 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.437 |
|---|
| InChIKey | DVSDDICSXBCMQJ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(C(C)=O)C(=O)OCC |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Diethyl acetosuccinate |
| Succinic acid, acetyl-, diethyl ester |
| Butanedioic acid, 2-acetyl-, diethyl ester |
| diethyl 2-acetylbutanedioate |
| EINECS 214-223-8 |
| Diethyl 2-acetylsuccinate |
| Diethyl acetylsuccinates |
| Ethyl acetylsuccinate |
| MFCD00009157 |
| Butanedioic acid, acetyl-, diethyl ester |