Introduction：Basic information about CAS 80632-52-6|Leu-Enkephalin (sulfated), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Leu-Enkephalin (sulfated) |
|---|
| CAS Number | 80632-52-6 | Molecular Weight | 635.68600 |
|---|
| Density | 1.371 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C28H37N5O10S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-3-(4-sulfooxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.371 g/cm3 |
|---|
| Molecular Formula | C28H37N5O10S |
|---|
| Molecular Weight | 635.68600 |
|---|
| Exact Mass | 635.22600 |
|---|
| PSA | 251.70000 |
|---|
| LogP | 2.65810 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | WMLDZIPRMZWLPL-VABKMULXSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
|---|
Synonyms
| Tyr-O-sulfated leucine enkephalin |
| O-Sulfated leu-enkephalin |
| Sulfonated leucine enkephalin |
| Sulfonated leu-enkephalin |
| leu-enkephalin sulfate |
| Leucine-enkephalin sulphate |
| Enkephalin-leu,sulfonated |
| Leu-Enkephalin (sulfated) |
