Introduction：Basic information about CAS 19040-62-1|2,5-Dimethylbenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Dimethylbenzene-1-sulfonyl chloride |
|---|
| CAS Number | 19040-62-1 | Molecular Weight | 204.67400 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 77 °C |
|---|
| Molecular Formula | C8H9ClO2S | Melting Point | 156-158℃ |
|---|
| MSDS | USA | Flash Point | 21°C |
|---|
Names
| Name | 2,5-dimethylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 77 °C |
|---|
| Melting Point | 156-158℃ |
|---|
| Molecular Formula | C8H9ClO2S |
|---|
| Molecular Weight | 204.67400 |
|---|
| Flash Point | 21°C |
|---|
| Exact Mass | 204.00100 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.31170 |
|---|
| Vapour Pressure | 0.00264mmHg at 25°C |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c(S(=O)(=O)Cl)c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|
| Risk Phrases | R10 |
|---|
| Safety Phrases | S16-S26-S36/37/39 |
|---|
| RIDADR | 2920 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,5-Dimethylbenzenesulfonyl chloride |
| 4-methyltoluenesulfonyl chloride |
| p-Xylene-2-sulfonyl chloride |
| p-methyltoluenesulphonyl chloride |
| 2,5-dimethylbenzene-1-sulfonyl chloride |
| 2,4-DIMETHYLPHENOXYACETIC ACID HYDRAZIDE |
| MFCD00024875 |
| 2,5-dimethylphenylsulfonyl chloride |
| 2,5-dimethyl-benzene-sulfonyl chloride |
| 2,5-Dimethylbenzenesulphonyl chloride |
