Introduction：Basic information about CAS 80120-36-1|ethyl 4-tert-butylbenzoylformate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-tert-butylbenzoylformate |
|---|
| CAS Number | 80120-36-1 | Molecular Weight | 234.29100 |
|---|
| Density | 1.045g/cm3 | Boiling Point | 104-110/0.1mm |
|---|
| Molecular Formula | C14H18O3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 139.4ºC |
|---|
Names
| Name | ethyl 2-(4-tert-butylphenyl)-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.045g/cm3 |
|---|
| Boiling Point | 104-110/0.1mm |
|---|
| Molecular Formula | C14H18O3 |
|---|
| Molecular Weight | 234.29100 |
|---|
| Flash Point | 139.4ºC |
|---|
| Exact Mass | 234.12600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.72990 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | VQDPLASXAHWKJX-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1ccc(C(C)(C)C)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Ethyl 4-tert-butylbenzoylformate |
| MFCD01934865 |
| p-tert.-Butyl-phenylglyoxylsaeure-ethylester |
