Introduction：Basic information about CAS 73287-51-1|6-amino-5-[[2-[(decylamino)sulphonyl]phenyl]azo]-4-hydroxynaphthalene-2-sulpho, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-amino-5-[[2-[(decylamino)sulphonyl]phenyl]azo]-4-hydroxynaphthalene-2-sulphonic acid |
|---|
| CAS Number | 73287-51-1 | Molecular Weight | 562.70100 |
|---|
| Density | 1.37g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C26H34N4O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-[2-[2-(decylsulfamoyl)phenyl]hydrazinyl]-6-imino-4-oxonaphthalene-2-sulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Molecular Formula | C26H34N4O6S2 |
|---|
| Molecular Weight | 562.70100 |
|---|
| Exact Mass | 562.19200 |
|---|
| PSA | 182.28000 |
|---|
| LogP | 7.26270 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | BRIXFSJPRLWHBH-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCCNS(=O)(=O)c1ccccc1N=Nc1c(N)ccc2cc(S(=O)(=O)O)cc(O)c12 |
|---|
