Introduction：Basic information about CAS 428-07-9|Levomepate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Levomepate |
|---|
| CAS Number | 428-07-9 | Molecular Weight | 303.39600 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 440.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220ºC |
|---|
Names
| Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-methyl-2-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 440.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25NO3 |
|---|
| Molecular Weight | 303.39600 |
|---|
| Flash Point | 220ºC |
|---|
| Exact Mass | 303.18300 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 2.04290 |
|---|
| Vapour Pressure | 1.6E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | XZPAMMPYTOAFOU-UHFFFAOYSA-N |
|---|
| SMILES | CN1C2CCC1CC(OC(=O)C(C)(CO)c1ccccc1)C2 |
|---|
Synonyms
| Atromepine |
| Levomepat |
| Atromepinum |
| Atromepina |
