Introduction：Basic information about CAS 35474-99-8|1-eicosanoyl-rac-glycerol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-eicosanoyl-rac-glycerol |
|---|
| CAS Number | 35474-99-8 | Molecular Weight | 386.609 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 506.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H46O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.7±19.4 °C |
|---|
Names
| Name | 1-arachidonoylglycerol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 506.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H46O4 |
|---|
| Molecular Weight | 386.609 |
|---|
| Flash Point | 158.7±19.4 °C |
|---|
| Exact Mass | 386.339600 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 8.68 |
|---|
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.469 |
|---|
| InChIKey | DCPCOKIYJYGMDN-DOFZRALJSA-N |
|---|
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(O)CO |
|---|
Safety Information
Customs
| HS Code | 2916190090 |
|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| Glyceryl arachidonate |
| 2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| 2,3-Dihydroxypropyl icosanoate |
| 1-Monoarachidin |
| 1-Arachidonyl monoglyceride |
| 1-arachidonoyl glycerol |
| 5,8,11,14-eicosatetraenoic acid 2,3-dihydroxypropyl ester |
| Glyceryl monoarachidonate |
| 2-arachidonoylglycerol |
| 1-Arachidonoyl-sn-glycerol |
| 1-eicosanoyl-rac-glycerol |
| Eicosanoic acid, 2,3-dihydroxypropyl ester |
| 1-(1,2-Dihydroxyethoxy)-2-henicosanone |
| 2-arachidonyl glycerol |
| 2-Heneicosanone, 1-(1,2-dihydroxyethoxy)- |
