Introduction：Basic information about CAS 55260-24-7|N-Boc-N'-(9-xanthenyl)-L-glutamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-N'-(9-xanthenyl)-L-glutamine |
|---|
| CAS Number | 55260-24-7 | Molecular Weight | 426.462 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 669.8±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H26N2O6 | Melting Point | ~150 °C (dec.) |
|---|
| MSDS | / | Flash Point | 358.9±31.5 °C |
|---|
Names
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 669.8±55.0 °C at 760 mmHg |
|---|
| Melting Point | ~150 °C (dec.) |
|---|
| Molecular Formula | C23H26N2O6 |
|---|
| Molecular Weight | 426.462 |
|---|
| Flash Point | 358.9±31.5 °C |
|---|
| Exact Mass | 426.179077 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 4.91 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | HOIIDGIJEPOSLL-INIZCTEOSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| BOC-Nd-XANTHYL-L-GLUTAMINE |
| L-Glutamine, N-[(1,1-dimethylethoxy)carbonyl]-N-9H-xanthen-9-yl- |
| MFCD00066158 |
| N-Boc-N'-xanthyl-L-glutamine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-N-9H-xanthen-9-yl-L-glutamine |
| AmbotzBAA1089 |
| N-(tert-Butoxycarbonyl)-N-9H-xanthen-9-yl-L-glutamine |
| N-Boc-N'-(9-xanthenyl)-L-glutamine |
| Boc-Gln(Xan)-OH |
