Introduction:Basic information about CAS 85098-88-0|1-(4'-Bromobiphenyl-4-yl)-3-phenylpropenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4'-Bromobiphenyl-4-yl)-3-phenylpropenone |
|---|
| CAS Number | 85098-88-0 | Molecular Weight | 363.24700 |
|---|
| Density | 1.338 | Boiling Point | 504ºC |
|---|
| Molecular Formula | C21H15BrO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 58ºC |
|---|
Names
| Name | 1-[4-(4-bromophenyl)phenyl]-3-phenylprop-2-en-1-one |
|---|
Chemical & Physical Properties
| Density | 1.338 |
|---|
| Boiling Point | 504ºC |
|---|
| Molecular Formula | C21H15BrO |
|---|
| Molecular Weight | 363.24700 |
|---|
| Flash Point | 58ºC |
|---|
| Exact Mass | 362.03100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 6.01220 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | NTCBUXIQMLORSI-GIDUJCDVSA-N |
|---|
| SMILES | O=C(C=Cc1ccccc1)c1ccc(-c2ccc(Br)cc2)cc1 |
|---|