Introduction:Basic information about CAS 20443-74-7|4'-chloro[1,1'-biphenyl]-4-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-chloro[1,1'-biphenyl]-4-sulfonyl chloride |
|---|
| CAS Number | 20443-74-7 | Molecular Weight | 287.16200 |
|---|
| Density | 1.412 g/cm3 | Boiling Point | 400.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2O2S | Melting Point | 109ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 196.2ºC |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-(4-chlorophenyl)benzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.412 g/cm3 |
|---|
| Boiling Point | 400.8ºC at 760 mmHg |
|---|
| Melting Point | 109ºC |
|---|
| Molecular Formula | C12H8Cl2O2S |
|---|
| Molecular Weight | 287.16200 |
|---|
| Flash Point | 196.2ºC |
|---|
| Exact Mass | 285.96200 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 5.01530 |
|---|
| Vapour Pressure | 2.86E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | NWYUSJMIHFIMTA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccc(Cl)cc2)cc1 |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 14-34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 8 / PGII |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4'-Chlorobiphenyl-4-sulfonyl chloride |
| 4'-chloro-4-biphenylylsulphonyl chloride |
| F9995-0464 |
| MFCD01631918 |
| 4PNS-Q02-0 |
| AR2084 |