Introduction：Basic information about CAS 21379-33-9|4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol |
|---|
| CAS Number | 21379-33-9 | Molecular Weight | 212.09000 |
|---|
| Density | 1.527g/cm3 | Boiling Point | 177.032ºC at 760 mmHg |
|---|
| Molecular Formula | C5H6F6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 60.867ºC |
|---|
Names
| Name | 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.527g/cm3 |
|---|
| Boiling Point | 177.032ºC at 760 mmHg |
|---|
| Molecular Formula | C5H6F6O2 |
|---|
| Molecular Weight | 212.09000 |
|---|
| Flash Point | 60.867ºC |
|---|
| Exact Mass | 212.02700 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 1.22450 |
|---|
| Vapour Pressure | 0.322mmHg at 25°C |
|---|
| Index of Refraction | 1.341 |
|---|
| InChIKey | PYTQULGOMFBQNV-UHFFFAOYSA-N |
|---|
| SMILES | OCCC(O)(C(F)(F)F)C(F)(F)F |
|---|
Synonyms
| 4,4,4-trifluoro-3-trifluoromethyl-butane-1,3-diol |
| 1,1,1-trifluoro-2-trifluoromethyl-2,4-butanediol |
| FD2106 |
