Introduction:Basic information about CAS 214045-67-7|1H-Pyrrolo[3,2-c]pyridine, 4-(1-piperazinyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[3,2-c]pyridine, 4-(1-piperazinyl)- |
|---|
| CAS Number | 214045-67-7 | Molecular Weight | 202.25600 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 453.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228ºC |
|---|
Names
| Name | 4-piperazin-1-yl-1H-pyrrolo[3,2-c]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 453.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14N4 |
|---|
| Molecular Weight | 202.25600 |
|---|
| Flash Point | 228ºC |
|---|
| Exact Mass | 202.12200 |
|---|
| PSA | 43.95000 |
|---|
| LogP | 1.36630 |
|---|
| Vapour Pressure | 2.07E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | OLFWGDMDZCFCPV-UHFFFAOYSA-N |
|---|
| SMILES | c1cc2[nH]ccc2c(N2CCNCC2)n1 |
|---|