Introduction:Basic information about CAS 306271-99-8|methyl 4-[4-(bromomethyl)phenyl]benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-[4-(bromomethyl)phenyl]benzoate |
|---|
| CAS Number | 306271-99-8 | Molecular Weight | 305.16700 |
|---|
| Density | 1.374g/cm3 | Boiling Point | 403.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.8ºC |
|---|
Names
| Name | methyl 4-[4-(bromomethyl)phenyl]benzoate |
|---|
Chemical & Physical Properties
| Density | 1.374g/cm3 |
|---|
| Boiling Point | 403.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO2 |
|---|
| Molecular Weight | 305.16700 |
|---|
| Flash Point | 197.8ºC |
|---|
| Exact Mass | 304.01000 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.03510 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | ITBUSBAYFDTECF-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2ccc(CBr)cc2)cc1 |
|---|