Introduction：Basic information about CAS 118060-27-8|4-NITRODIBENZO-18-CROWN-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-NITRODIBENZO-18-CROWN-6 |
|---|
| CAS Number | 118060-27-8 | Molecular Weight | 405.39900 |
|---|
| Density | 1.202g/cm3 | Boiling Point | 562.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H23NO8 | Melting Point | 190-195ºC |
|---|
| MSDS | / | Flash Point | 222.4ºC |
|---|
Names
| Name | 2-Nitro-6,7,9,10,17,18,20,21-octahydrodibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.202g/cm3 |
|---|
| Boiling Point | 562.8ºC at 760mmHg |
|---|
| Melting Point | 190-195ºC |
|---|
| Molecular Formula | C20H23NO8 |
|---|
| Molecular Weight | 405.39900 |
|---|
| Flash Point | 222.4ºC |
|---|
| Exact Mass | 405.14200 |
|---|
| PSA | 101.20000 |
|---|
| LogP | 3.72780 |
|---|
| Vapour Pressure | 4.12E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | ILLUPZYAROEJNS-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCOCCOc1ccccc1OCCOCCO2 |
|---|
Synonyms
| Dibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecin,6,7,9,10,17,18,20,21-octahydro-2-nitro |
| 4'-nitro-DB18C6 |
| 20-nitro-2,3,11,12-dibenzo-1,4,7,10,13,16-hexaoxa-2,11-cyclooctadecadiene |
| F0138-0350 |
| 4'-Nitrodibenzo-18-crown-6 |
