Introduction：Basic information about CAS 7570-41-4|5-(3-ethyl-2(3h)-benzothiazolylidene)-4-oxo-2-thioxo-3- thiazolidineacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(3-ethyl-2(3h)-benzothiazolylidene)-4-oxo-2-thioxo-3- thiazolidineacetic acid triethylamine salt |
|---|
| CAS Number | 7570-41-4 | Molecular Weight | 435.60300 |
|---|
| Density | 1.64g/cm3 | Boiling Point | 453.7ºC at 760 mmHg |
|---|
| Molecular Formula | C21H29N3O3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.2ºC |
|---|
Names
| Name | 5-(3-ethyl-2(3h)-benzothiazolylidene)-4-oxo-2-thioxo-3- thiazolidineacetic acid triethylamine salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.64g/cm3 |
|---|
| Boiling Point | 453.7ºC at 760 mmHg |
|---|
| Molecular Formula | C21H29N3O3S2 |
|---|
| Molecular Weight | 435.60300 |
|---|
| Flash Point | 228.2ºC |
|---|
| Exact Mass | 435.16500 |
|---|
| PSA | 121.48000 |
|---|
| LogP | 3.57650 |
|---|
| Index of Refraction | 1.804 |
|---|
| InChIKey | JIGTUJHXEHURKA-UHFFFAOYSA-N |
|---|
| SMILES | CCN1C(=C2SC(=S)N(CC(=O)O)C2=O)Sc2ccccc21 |
|---|
Synonyms
| 5-[3-Ethylbenzothiazol-2(3H)-ylidene]-4-oxo-2-thioxo-3-thiazolidineacetic acid |
| 5-(3-ethylbenzothiazol-2(3H)-ylidene)-4-oxo-2-thioxothiazolidin-3-acetic acid |
| 5-[3-Ethylbenzothiazol-2(3H)-ylidene]-4-oxo-2-thioxothiazolidine-3-acetic acid |
