Introduction：Basic information about CAS 953-91-3|Cyclohexyl p-Toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclohexyl p-Toluenesulfonate |
|---|
| CAS Number | 953-91-3 | Molecular Weight | 254.34500 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 382.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3S | Melting Point | 45-46ºC |
|---|
| MSDS | / | Flash Point | 184.9ºC |
|---|
Names
| Name | cyclohexyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 382.1ºC at 760 mmHg |
|---|
| Melting Point | 45-46ºC |
|---|
| Molecular Formula | C13H18O3S |
|---|
| Molecular Weight | 254.34500 |
|---|
| Flash Point | 184.9ºC |
|---|
| Exact Mass | 254.09800 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 4.11380 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | OHHPZPDQZMUTCA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCCC2)cc1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2906199090 |
|---|
Customs
| HS Code | 2906199090 |
|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| ((4-methylbenzenesulfonyl)oxy)cyclohexane |
| MFCD000142912 |
| cyclohexyl-p-tosylate |
| cyclohexanol tosylate |
| Cyclohexyl p-toluenesulfonate |
| Cyclohexyl toluenesulfonate |
| p-Toluenesulfonic acid,cyclohexyl ester |
| CYCLOHEXYL TOSYLATE |
| toluene-4-sulfonic acid cyclohexyl ester |
| EINECS 213-468-8 |
| Benzenesulfonic acid,4-methyl-,cyclohexyl ester |
| Tosyloxycyclohexane |
