Introduction：Basic information about CAS 51727-47-0|2-[[(phenylamino)carbonyl]oxy]ethyl methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[(phenylamino)carbonyl]oxy]ethyl methacrylate |
|---|
| CAS Number | 51727-47-0 | Molecular Weight | 249.26200 |
|---|
| Density | 1.188g/cm3 | Boiling Point | 337.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.7ºC |
|---|
Names
| Name | 2-(phenylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.188g/cm3 |
|---|
| Boiling Point | 337.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO4 |
|---|
| Molecular Weight | 249.26200 |
|---|
| Flash Point | 157.7ºC |
|---|
| Exact Mass | 249.10000 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 2.42740 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | UQFMGLLQCSSNQM-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OCCOC(=O)Nc1ccccc1 |
|---|
Synonyms
| 2-(((Phenylamino)carbonyl)oxy)ethyl methacrylate |
| EINECS 257-359-3 |
| 2-[(phenylcarbamoyl)oxy]ethylmethacrylate |
