Introduction:Basic information about CAS 126393-38-2|5-[4-(TERT-BUTYL)PHENYL]-2H-1,2,3,4-TETRAAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[4-(TERT-BUTYL)PHENYL]-2H-1,2,3,4-TETRAAZOLE |
|---|
| CAS Number | 126393-38-2 | Molecular Weight | 202.25600 |
|---|
| Density | 1.127g/cm3 | Boiling Point | 344.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H14N4 | Melting Point | 193-195ºC |
|---|
| MSDS | / | Flash Point | 152.9ºC |
|---|
Names
| Name | 5-(4-tert-butylphenyl)-2H-tetrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.127g/cm3 |
|---|
| Boiling Point | 344.5ºC at 760mmHg |
|---|
| Melting Point | 193-195ºC |
|---|
| Molecular Formula | C11H14N4 |
|---|
| Molecular Weight | 202.25600 |
|---|
| Flash Point | 152.9ºC |
|---|
| Exact Mass | 202.12200 |
|---|
| PSA | 54.46000 |
|---|
| LogP | 2.16420 |
|---|
| Vapour Pressure | 6.57E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | QHSLNQKCYGFLER-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(-c2nn[nH]n2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Risk Phrases | R11 |
|---|
| Safety Phrases | S16 |
|---|
Synonyms
| p-tert-butylphenyltetrazole |
| 5-(4-tert-butylphenyl)-1H-tetrazole |
| 5-(4-t-butylphenyl)-1H-tetrazole |
| 5-(4-tert-butylphenyl)tetrazole |
| 2H-Tetrazole,5-[4-(1,1-dimethylethyl)phenyl] |
| 5-(4-t-butylphenyl)tetrazole |
| 5-[4-(Tert-Butyl)Phenyl]-2H-1,2,3,4-Tetraazole |