Introduction：Basic information about CAS 4269-19-6|9H-Fluorene-4-carboxylicacid, 9-oxo-, methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Fluorene-4-carboxylicacid, 9-oxo-, methyl ester |
|---|
| CAS Number | 4269-19-6 | Molecular Weight | 238.23800 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 420.3ºC at 760mmHg |
|---|
| Molecular Formula | C15H10O3 | Melting Point | 135-136ºC |
|---|
| MSDS | / | Flash Point | 189.7ºC |
|---|
Names
| Name | methyl 9-oxofluorene-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 420.3ºC at 760mmHg |
|---|
| Melting Point | 135-136ºC |
|---|
| Molecular Formula | C15H10O3 |
|---|
| Molecular Weight | 238.23800 |
|---|
| Flash Point | 189.7ºC |
|---|
| Exact Mass | 238.06300 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.68460 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | WSTDJPDRIAZQON-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc2c1-c1ccccc1C2=O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| fluoren-9-one-4-carboxylic acid methyl ester |
| Fluorenon-4-carbonsaeure-methylester |
| 9-oxo-9H-fluorene-4-carboxylic acid methyl ester |
| 9-Oxofluoren-4-carbonsaeure-methylester |
| 9-oxo-fluorene-4-carboxylic acid methyl ester |
| methyl 9-oxo-9h-fluorene-4-carboxylate |
