Introduction：Basic information about CAS 54022-96-7|5-(3-methoxyphenyl)furan-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(3-methoxyphenyl)furan-2-carboxylic acid |
|---|
| CAS Number | 54022-96-7 | Molecular Weight | 218.20500 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 393.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H10O4 | Melting Point | 169ºC |
|---|
| MSDS | USA | Flash Point | 191.8ºC |
|---|
Names
| Name | 5-(3-methoxyphenyl)furan-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 393.5ºC at 760mmHg |
|---|
| Melting Point | 169ºC |
|---|
| Molecular Formula | C12H10O4 |
|---|
| Molecular Weight | 218.20500 |
|---|
| Flash Point | 191.8ºC |
|---|
| Exact Mass | 218.05800 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 2.65340 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | RIIFZAPFLSKUTL-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(-c2ccc(C(=O)O)o2)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 5-(3-methoxy-phenyl)-furan-2-carboxylic acid |
| 5-(3-methoxyphenyl)-2-furoic acid |
| 5-(3-Methoxyphenyl)-2-carboxy-furan |
| 5-(3-Methoxyphenyl)furan-2-carboxylic acid |
| 5-(3-Methoxyphenyl)-2-furancarbonsaeure |
