Introduction:Basic information about CAS 1138-56-3|4-Butoxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Butoxybenzenesulfonyl chloride |
|---|
| CAS Number | 1138-56-3 | Molecular Weight | 248.726 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 354.0±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13ClO3S | Melting Point | 19 °C |
|---|
| MSDS | / | Flash Point | 167.9±20.4 °C |
|---|
Names
| Name | 4-butoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 354.0±15.0 °C at 760 mmHg |
|---|
| Melting Point | 19 °C |
|---|
| Molecular Formula | C10H13ClO3S |
|---|
| Molecular Weight | 248.726 |
|---|
| Flash Point | 167.9±20.4 °C |
|---|
| Exact Mass | 248.027390 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 4.10 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.520 |
|---|
| InChIKey | HGKWMUBXVMFXNC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(S(=O)(=O)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3265 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| para-n-butoxyphenylsulfonyl chloride |
| 4-Butoxybenzenesulfonyl chloride |
| p-n-butoxybenzenesulfonyl chloride |
| 4-(n-butoxy)-benzenesulfonyl chloride |
| Benzenesulfonyl chloride, 4-butoxy- |
| 4-butoxybenzene-1-sulfonyl chloride |
| MFCD00052344 |
| 4-Butoxybenzenesulfonylchloride |
| 4-(n-butoxy)-phenylsulfonyl chloride |
| 4-(N-butoxy)benzenesulphonyl chloride |