Introduction:Basic information about CAS 84-32-2|3-chloro-9,10-dihydro-9,10-dioxoanthracene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-9,10-dihydro-9,10-dioxoanthracene-2-carboxylic acid |
|---|
| CAS Number | 84-32-2 | Molecular Weight | 286.66700 |
|---|
| Density | 1.561g/cm3 | Boiling Point | 551.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H7ClO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 287.3ºC |
|---|
Names
| Name | 3-chloro-9,10-dioxoanthracene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.561g/cm3 |
|---|
| Boiling Point | 551.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H7ClO4 |
|---|
| Molecular Weight | 286.66700 |
|---|
| Flash Point | 287.3ºC |
|---|
| Exact Mass | 286.00300 |
|---|
| PSA | 71.44000 |
|---|
| LogP | 2.81360 |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | DHDYWKZMHZPMFZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2c(cc1Cl)C(=O)c1ccccc1C2=O |
|---|
Synonyms
| EINECS 201-526-5 |
| 2-chloro-3-carboxyanthraquinone |
| 3-chloroanthraquinone-2-carboxylic acid |
| 3-Chlor-anthrachinon-carbonsaeure-(2) |
| 3-Chloro-9,10-dihydro-9,10-dioxoanthracene-2-carboxylic acid |
| 3-Chlor-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| 2-chloroanthraquinone-3-carboxylic acid |
| 3-Chloro-9,10-dihydro-9,10-dioxo-2-anthracenecarboxylic acid |
| 3-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |