Introduction：Basic information about CAS 860205-92-1|7-bromo-4-hydroxyquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-bromo-4-hydroxyquinoline-3-carboxylic acid |
|---|
| CAS Number | 860205-92-1 | Molecular Weight | 268.064 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 408.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.6±28.7 °C |
|---|
Names
| Name | 7-bromo-4-oxo-1H-quinoline-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 408.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO3 |
|---|
| Molecular Weight | 268.064 |
|---|
| Flash Point | 200.6±28.7 °C |
|---|
| Exact Mass | 266.953094 |
|---|
| PSA | 70.16000 |
|---|
| LogP | 3.48 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | SKEXUXOCAHNLRH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c[nH]c2cc(Br)ccc2c1=O |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-Bromo-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
| 7-bromo-4-hydroxy-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 7-bromo-1,4-dihydro-4-oxo- |
| 7-bromo-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| 3-quinolinecarboxylic acid, 7-bromo-4-hydroxy- |
| 7-bromo-4-hydroxyquinoline-3-carboxylic acid |
| 7-Brom-4-hydroxy-chinolin-3-carbonsaeure |
| 7-bromo-4-hydroxy-quinoline-3-carboxylic acid |
