Introduction：Basic information about CAS 2003-10-3|2-Bromo-1-(3-(trifluoromethyl)phenyl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-1-(3-(trifluoromethyl)phenyl)ethanone |
|---|
| CAS Number | 2003-10-3 | Molecular Weight | 267.043 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 232.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6BrF3O | Melting Point | 22ºC |
|---|
| MSDS | / | Flash Point | 94.4±25.9 °C |
|---|
Names
| Name | 2-bromo-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 232.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 22ºC |
|---|
| Molecular Formula | C9H6BrF3O |
|---|
| Molecular Weight | 267.043 |
|---|
| Flash Point | 94.4±25.9 °C |
|---|
| Exact Mass | 265.955414 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.25 |
|---|
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.496 |
|---|
| InChIKey | TZIYNLSEBAYCBZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)c1cccc(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 1760 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone |
| 3'-(Trifluoromethyl)phenacyl bromide |
| 2-bromo-3'-trifluoromethyl-acetophenone |
| 2-Bromo-3-(trifluoromethyl)acetophenone |
| 3-trifluoromethylphenacyl bromide |
| 2-bromo-1-[3-(trifluoromethyl)phenyl]ethan-1-one |
| MFCD03094283 |
| 2-Bromo-1-[3-(trifluoromethyl)phenyl]ethanone |
| 2-Bromo-3'-(trifluoromethyl)acetophenone |
| 2-Bromo-3′-(trifluoromethyl)acetophenone |
| Ethanone, 2-bromo-1-[3-(trifluoromethyl)phenyl]- |
| FXFFR CV1E |
| m-(Trifluoromethyl)phenacyl Bromide |
| 2-bromo-1-(3-(trifluoromethyl)phenyl)ethanone |
