Introduction：Basic information about CAS 5361-54-6|4-Benzenesulfonylbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Benzenesulfonylbenzoic acid |
|---|
| CAS Number | 5361-54-6 | Molecular Weight | 262.281 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 486.6±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.1±24.0 °C |
|---|
Names
| Name | 4-(benzenesulfonyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 486.6±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10O4S |
|---|
| Molecular Weight | 262.281 |
|---|
| Flash Point | 248.1±24.0 °C |
|---|
| Exact Mass | 262.029968 |
|---|
| PSA | 79.82000 |
|---|
| LogP | 2.53 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | PKXDNBNSQBZKFO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| p-carboxydiphenyl sulphone |
| 4-(Phenylsulfonyl)benzoic acid |
| 4-Benzenesulfonyl-benzoic acid |
| 4-Phenylsulfon-benzoesaeure |
| Benzoic acid, 4-(phenylsulfonyl)- |
| 4-Benzenesulfonylbenzoic acid |
| 4-Benzolsulfonyl-benzoesaeure |
