Introduction:Basic information about CAS 359875-09-5|ct supplement, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ct supplement |
|---|
| CAS Number | 359875-09-5 | Molecular Weight | 300.37400 |
|---|
| Density | / | Boiling Point | 572.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21FN4 | Melting Point | 153-159ºC(lit.) |
|---|
| MSDS | / | Flash Point | 300.1ºC |
|---|
Names
| Name | (2S,3S)-2-benzhydryl-N-[(5-tert-butyl-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine,2-hydroxypropane-1,2,3-tricarboxylic acid,hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 572.6ºC at 760 mmHg |
|---|
| Melting Point | 153-159ºC(lit.) |
|---|
| Molecular Formula | C17H21FN4 |
|---|
| Molecular Weight | 300.37400 |
|---|
| Flash Point | 300.1ºC |
|---|
| Exact Mass | 300.17500 |
|---|
| PSA | 33.95000 |
|---|
| LogP | 2.92460 |
|---|
| Appearance of Characters | grit |
|---|
| InChIKey | PGVSXRHFXJOMGW-YBZGWEFGSA-N |
|---|
| SMILES | COc1ccc(C(C)(C)C)cc1CNC1C2CCN(CC2)C1C(c1ccccc1)c1ccccc1.O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | H2O: 1 M at 20 °C, clear, colorless |
|---|
Safety Information
| Hazard Codes | Xi: Irritant;T: Toxic; |
|---|
| Risk Phrases | 41-42/43-36/37/38-25 |
|---|
| Safety Phrases | 26-39-45-36/37-22 |
|---|
| RIDADR | UN 3284 6.1/PG 3 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | GE7350000 |
|---|
Synonyms
| Cerenia |
| UNII-LXN6S3999X |
| MFCD02098080 |
| LXN6S3999X |
| Maropitant citrate [USAN] |
| (2S,3S)-2-benzhydryl-N-(5-tert-butyl-2-methoxybenzyl)quinuclidin-3-amine citrate monohydrate |
| Maropitant citrate |
| EINECS 201-069-1 |