Introduction：Basic information about CAS 201532-01-6|Fmoc-Pen(Trt)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Pen(Trt)-OH |
|---|
| CAS Number | 201532-01-6 | Molecular Weight | 613.765 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 768.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H35NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 418.8±32.9 °C |
|---|
Names
| Name | Fmoc-S-trityl-D-penicillamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 768.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H35NO4S |
|---|
| Molecular Weight | 613.765 |
|---|
| Flash Point | 418.8±32.9 °C |
|---|
| Exact Mass | 613.228699 |
|---|
| PSA | 100.93000 |
|---|
| LogP | 10.66 |
|---|
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | XSGMGAINOILNJR-DHUJRADRSA-N |
|---|
| SMILES | CC(C)(SC(c1ccccc1)(c1ccccc1)c1ccccc1)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| Storage condition | -15°C |
|---|
Safety Information
Synonyms
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(tritylsulfanyl)-D-valine |
| D-Valine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-[(triphenylmethyl)thio]- |
| Fmoc-Pen(Trt)-OH |
| (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-methyl-3-(tritylthio)butanoic acid |
| fmoc-d-pen(trt)-oh |
| Fmoc-S-trityl-D-penicillamine |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid |
