Introduction：Basic information about CAS 517905-87-2|fmoc-(r)-3-amino-3-(3-trifluoromethyl-phenyl)-propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-(r)-3-amino-3-(3-trifluoromethyl-phenyl)-propionic acid |
|---|
| CAS Number | 517905-87-2 | Molecular Weight | 455.426 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 603.8±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 319.0±31.5 °C |
|---|
Names
| Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 603.8±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 |
|---|
| Molecular Weight | 455.426 |
|---|
| Flash Point | 319.0±31.5 °C |
|---|
| Exact Mass | 455.134430 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.73 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | YOGSOMNKKBEWAJ-JOCHJYFZSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc(C(F)(F)F)c1 |
|---|
Synonyms
| (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| Fmoc-(R)-3-Amino-3-(3-trifluoromethyl-phenyl)-propionic acid |
| (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-(trifluoromethyl)phenyl)propanoic acid |
| Benzenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-(trifluoromethyl)-, (βR)- |
| FMOC-PHG(3-CF3)-(C*CH2)OH |
| Fmoc-3-Trifluoromethyl-D-b-phenylalanine |
