Introduction:Basic information about CAS 1210-66-8|9H-Purin-6-amine,N-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Purin-6-amine,N-phenyl- |
|---|
| CAS Number | 1210-66-8 | Molecular Weight | 211.22300 |
|---|
| Density | 1.431g/cm3 | Boiling Point | 541.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H9N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.1ºC |
|---|
Names
| Name | N-phenyl-7H-purin-6-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.431g/cm3 |
|---|
| Boiling Point | 541.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H9N5 |
|---|
| Molecular Weight | 211.22300 |
|---|
| Flash Point | 281.1ºC |
|---|
| Exact Mass | 211.08600 |
|---|
| PSA | 66.49000 |
|---|
| LogP | 2.16950 |
|---|
| Vapour Pressure | 2.74E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.761 |
|---|
| InChIKey | WCZNSRQVTJYMRQ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(Nc2ncnc3nc[nH]c23)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| N6-Phenylaminopurine |
| 6-Anilinopurine |
| N-phenyl-9H-purin-6-amine |
| 6-Phenylaminopurine |
| Adenine,N-phenyl |
| phenyl-(7(9)H-purin-6-yl)-amine |
| N-Purin-6-ylaniline |
| 1H-Purin-6-amine,N-phenyl |
| 6-Anilino-9H-purine |
| N6-phenyladenine |
| PHENYL(9H-PURIN-6-YL)AMINE |
| N-Phenyladenine |