CAS 20924-05-4|Thymine-1-acetic acid
Introduction：Basic information about CAS 20924-05-4|Thymine-1-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Thymine-1-acetic acid | ||
|---|---|---|---|
| CAS Number | 20924-05-4 | Molecular Weight | 184.149 |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 424.4ºC at 760 mmHg |
| Molecular Formula | C7H8N2O4 | Melting Point | 272-278ºC (dec.)(lit.) |
| MSDS | ChineseUSA | Flash Point | 210.5ºC |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760 mmHg |
| Melting Point | 272-278ºC (dec.)(lit.) |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.149 |
| Flash Point | 210.5ºC |
| Exact Mass | 184.048401 |
| PSA | 92.16000 |
| LogP | -0.80 |
| Vapour Pressure | 5.57E-09mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | TZDMCKHDYUDRMB-UHFFFAOYSA-N |
| SMILES | Cc1cn(CC(=O)O)c(=O)[nH]c1=O |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2933599090 |
Customs
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles4
More Articles| Synthesis and properties of DNA-PNA chimeric oligomers. Nucleic Acids Res. 24(17) , 3357-63, (1996) Adenine, thymine and cytosine PNA monomers have been prepared using 3-amino-1,2-propanediol as a starting material. The benzoyl group was used to protect the exocyclic amines of the heterocyclic bases... | |
| Semiconductive and magnetic one-dimensional coordination polymers of Cu(II) with modified nucleobases. Inorg. Chem. 52(19) , 11428-37, (2013) Four new copper(II) coordination complexes, obtained by reaction of CuX2 (X = acetate or chloride) with thymine-1-acetic acid and uracil-1-propionic acid as ligands, of formulas [Cu(TAcO)2(H2O)4]·4H2O... | |
| Functionalized gold nanoparticles/reduced graphene oxide nanocomposites for ultrasensitive electrochemical sensing of mercury ions based on thymine-mercury-thymine structure. Biosens. Bioelectron. 79 , 320-6, (2016) A sensitive, selective and reusable electrochemical biosensor for the determination of mercury ions (Hg(2+)) has been developed based on thymine (T) modified gold nanoparticles/reduced graphene oxide ... |
Synonyms
| 2-(1'-thyminyl)acetic acid |
| Thymin-1-yl-acetic acid |
| 2-(5-methyl-2,4-dioxo-1,3-dihydropyrimidinyl)acetic acid |
| (5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid |
| (5-Methyl-2,4-dioxo-3,4-dihydro-1(2H)-pyrimidinyl)acetic acid |
| AC1Q2OEY |
| THYMINE-1-ACETICACID |
| (thymin-1-yl)acetic acid |
| Thymine-1-acetic acid |
| 1-(carboxymethyl)thymine |
| 1(2H)-Pyrimidineacetic acid, 3,4-dihydro-5-methyl-2,4-dioxo- |
| 2-(5-Methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid |
| (5-Methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)acetic acid |
| AC1LGY5I |
| 2-(thymin-1yl)acetic acid |
