Introduction：Basic information about CAS 15190-14-4|1-Piperidineacetonitrile,a-(4-methoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Piperidineacetonitrile,a-(4-methoxyphenyl)- |
|---|
| CAS Number | 15190-14-4 | Molecular Weight | 230.30600 |
|---|
| Density | 1.094g/cm3 | Boiling Point | 342.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H18N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.8ºC |
|---|
Names
| Name | 2-(4-methoxyphenyl)-2-piperidin-1-ylacetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.094g/cm3 |
|---|
| Boiling Point | 342.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H18N2O |
|---|
| Molecular Weight | 230.30600 |
|---|
| Flash Point | 160.8ºC |
|---|
| Exact Mass | 230.14200 |
|---|
| PSA | 36.26000 |
|---|
| LogP | 2.68368 |
|---|
| Vapour Pressure | 7.62E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | CYRKWIBBOQIQTG-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(C#N)N2CCCCC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| (4-methoxy-phenyl)-piperidino-acetonitrile |
| (4-Methoxy-phenyl)-piperidino-acetonitril |
| 2-(4-methoxyphenyl)-2-piperidinoacetonitrile |
| (4-Methoxyphenyl)(1-piperidinyl)acetonitril |
| Piperidino-p-methoxyphenylacetonitril |
| (4-methoxyphenyl)(piperidin-1-yl)acetonitrile |
