Introduction：Basic information about CAS 116265-66-8|2-[difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]-1,1,2,3,3,4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]-1,1,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene |
|---|
| CAS Number | 116265-66-8 | Molecular Weight | 774.13400 |
|---|
| Density | 1.9g/cm3 | Boiling Point | 259.7ºC at 760mmHg |
|---|
| Molecular Formula | C17F30 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.1ºC |
|---|
Names
| Name | 2-[difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]-1,1,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9g/cm3 |
|---|
| Boiling Point | 259.7ºC at 760mmHg |
|---|
| Molecular Formula | C17F30 |
|---|
| Molecular Weight | 774.13400 |
|---|
| Flash Point | 109.1ºC |
|---|
| Exact Mass | 773.95200 |
|---|
| LogP | 9.11930 |
|---|
| Vapour Pressure | 0.0207mmHg at 25°C |
|---|
| Index of Refraction | 1.34 |
|---|
| InChIKey | DFGLLDMCDAKADU-UHFFFAOYSA-N |
|---|
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C2(F)C(F)(F)C(F)(F)C3(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C3(F)C2(F)F)C(F)(F)C1(F)F |
|---|
Synonyms
| Perfluoroperhydrobenzyl tetralin |
| Fiflow 260 |
| Perfluoroperhydrobenzyl tetralin [INCI] |
| UNII-XB88J87KY4 |
| PP 25 |
| Perfluoroperhydro-2-benzyltetralin |
