Introduction：Basic information about CAS 123402-21-1|3'-Deoxy-3'-fluoroguanosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3'-Deoxy-3'-fluoroguanosine |
|---|
| CAS Number | 123402-21-1 | Molecular Weight | 285.232 |
|---|
| Density | 2.2±0.1 g/cm3 | Boiling Point | 726.1±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12FN5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 392.9±35.7 °C |
|---|
Names
| Name | 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.2±0.1 g/cm3 |
|---|
| Boiling Point | 726.1±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12FN5O4 |
|---|
| Molecular Weight | 285.232 |
|---|
| Flash Point | 392.9±35.7 °C |
|---|
| Exact Mass | 285.087341 |
|---|
| PSA | 139.28000 |
|---|
| LogP | -0.19 |
|---|
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.876 |
|---|
| InChIKey | VDOWHLFGBWKXJC-DXTOWSMRSA-N |
|---|
| SMILES | Nc1nc2c(ncn2C2OC(CO)C(F)C2O)c(=O)[nH]1 |
|---|
Synonyms
| Guanosine, 3'-deoxy-3'-fluoro- |
| 3'-Deoxy-3'-fluoroguanosine |
| 2-Amino-9-((2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one |
| 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)-2-oxolanyl]-3H-purin-6-one |
