Introduction：Basic information about CAS 54395-52-7|1H-Isoindole-1,3(2H)-dione,5,5'-[(1-methylethylidene)bis(4,1-phenyleneoxy), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione,5,5'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis[2-methyl- |
|---|
| CAS Number | 54395-52-7 | Molecular Weight | 546.56900 |
|---|
| Density | 1.332 g/cm3 | Boiling Point | 692.1ºC at 760 mmHg |
|---|
| Molecular Formula | C33H26N2O6 | Melting Point | 146-148 °C |
|---|
| MSDS | / | Flash Point | 372.4ºC |
|---|
Names
| Name | 2-methyl-5-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.332 g/cm3 |
|---|
| Boiling Point | 692.1ºC at 760 mmHg |
|---|
| Melting Point | 146-148 °C |
|---|
| Molecular Formula | C33H26N2O6 |
|---|
| Molecular Weight | 546.56900 |
|---|
| Flash Point | 372.4ºC |
|---|
| Exact Mass | 546.17900 |
|---|
| PSA | 93.22000 |
|---|
| LogP | 5.92450 |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | QXYUOZCGMWHVJB-UHFFFAOYSA-N |
|---|
| SMILES | CN1C(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(Oc5ccc6c(c5)C(=O)N(C)C6=O)cc4)cc3)cc2C1=O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/22 |
|---|
| Safety Phrases | S22-S26-S36 |
|---|
Synonyms
| 2,2-bis[4-(N-methylphthalimide-4-oxy)phenyl]propane |
| 4,4'-[(isopropylidene)bis(p-phenyleneoxy)]bis[N-methylphthalimide] |
| Oxirane,2,2-di(trimethylsilyl) |
| 2,2-bis(trimethylsilyl)oxirane |
| oxirane-2,2-diylbis(trimethylsilane) |
| 1,1-bis(trimethylsilyl)epoxyethane |
| BPA bisimide |
| EINECS 259-143-4 |
| OXIRANYLIDENEBIS[TRIMETHYLSILANE] |
| 2,2-bis-trimethylsilanyl-oxirane |
