Introduction：Basic information about CAS 154486-27-8|fluroxypyr-butometyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fluroxypyr-butometyl |
|---|
| CAS Number | 154486-27-8 | Molecular Weight | 369.21600 |
|---|
| Density | 1.321 | Boiling Point | 453.692ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19Cl2FN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.185ºC |
|---|
Names
| Name | fluroxypyr-butometyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321 |
|---|
| Boiling Point | 453.692ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19Cl2FN2O4 |
|---|
| Molecular Weight | 369.21600 |
|---|
| Flash Point | 228.185ºC |
|---|
| Exact Mass | 368.07100 |
|---|
| PSA | 83.67000 |
|---|
| LogP | 3.81810 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | ZKFARSBUEBZZJT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOCC(C)OC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
|---|
Synonyms
| rac-(2R)-1-butoxypropan-2-yl [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate |
| 1-butoxypropan-2-yl 2-(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxyacetate |
| fluoroxypyr-butometyl |
| Fluroxypyr-butometyl [ISO] |
| 2-butoxy-1-methylethyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| Fluroxypyr-butometyl |
| (RS)-2-butoxy-1-methylethyl 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetate |
