Introduction：Basic information about CAS 19735-74-1|4-(Adamantan-1-yl)-1,3-thiazol-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Adamantan-1-yl)-1,3-thiazol-2-amine |
|---|
| CAS Number | 19735-74-1 | Molecular Weight | 234.360 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 190.2±19.3 °C |
|---|
Names
| Name | 4-(1-adamantyl)-1,3-thiazol-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 390.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2S |
|---|
| Molecular Weight | 234.360 |
|---|
| Flash Point | 190.2±19.3 °C |
|---|
| Exact Mass | 234.119064 |
|---|
| PSA | 67.15000 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | JVJWJUQLRDIVJV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-(adamant-1-yl)thiazol-2-ylamine |
| 4-(1-adamantyl)-2-aminothiazole |
| 4-adamantanyl-1,3-thiazole-2-ylamine |
| 2-Thiazolamine, 4-tricyclo[3.3.1.1]dec-1-yl- |
| 4-(Adamantan-1-yl)-1,3-thiazol-2-amine |
| 4-(tricyclo[3.3.1.1~3,7~]dec-1-yl)-1,3-thiazol-2-amine |
| 4-[(3s,5s,7s)-Adamantan-1-yl]-1,3-thiazol-2-amine |
| 4-adamantyl-2-aminothiazole |
| 4-(adamantan-1-yl)thiazol-2-amine |
| 4-Adamantan-1-yl-thiazol-2-ylamine |
