Introduction：Basic information about CAS 117559-37-2|Chloro(diisopropyl)octylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chloro(diisopropyl)octylsilane |
|---|
| CAS Number | 117559-37-2 | Molecular Weight | 262.934 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 293.1±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H31ClSi | Melting Point | <0ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 110.6±8.3 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | chloro-octyl-di(propan-2-yl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 293.1±9.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C14H31ClSi |
|---|
| Molecular Weight | 262.934 |
|---|
| Flash Point | 110.6±8.3 °C |
|---|
| Exact Mass | 262.188354 |
|---|
| LogP | 7.65 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.436 |
|---|
| InChIKey | SALITQCKMBTLPL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCC[Si](Cl)(C(C)C)C(C)C |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 2987 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
Synonyms
| Chlorodiisopropyloctylsilane |
| n-Octyldiisopropylchlorosilane |
| MFCD00134528 |
| Chloro(diisopropyl)octylsilane |
| Octyldiisopropylchlorosilane |
| Silane, chlorobis(1-methylethyl)octyl- |
| Diisopropyloctylchlorosilane |
