Introduction：Basic information about CAS 546-56-5|octaphenylcyclotetrasiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | octaphenylcyclotetrasiloxane |
|---|
| CAS Number | 546-56-5 | Molecular Weight | 793.171 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 334 °C |
|---|
| Molecular Formula | C48H40O4Si4 | Melting Point | 196-198 °C(lit.) |
|---|
| MSDS | / | Flash Point | 200 °C |
|---|
Names
| Name | Octaphenylcyclotetrasiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 334 °C |
|---|
| Melting Point | 196-198 °C(lit.) |
|---|
| Molecular Formula | C48H40O4Si4 |
|---|
| Molecular Weight | 793.171 |
|---|
| Flash Point | 200 °C |
|---|
| Exact Mass | 792.200378 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 5.09280 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | VSIKJPJINIDELZ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
|---|
| Water Solubility | insoluble |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | GZ4398500 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,2,4,4,6,6,8,8-octakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octaphenyl- |
| 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
| octaphenylcyclotetrasiloxane |
| MFCD00003268 |
| EINECS 208-904-9 |
