CAS 541-05-9|hexamethylcyclotrisiloxane
Introduction：Basic information about CAS 541-05-9|hexamethylcyclotrisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hexamethylcyclotrisiloxane | ||
|---|---|---|---|
| CAS Number | 541-05-9 | Molecular Weight | 222.462 |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 131.0±8.0 °C at 760 mmHg |
| Molecular Formula | C6H18O3Si3 | Melting Point | 50-64 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 26.4±18.8 °C |
| Symbol | GHS02 | Signal Word | Danger |
Names
| Name | Hexamethylcyclotrisiloxane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 131.0±8.0 °C at 760 mmHg |
| Melting Point | 50-64 °C(lit.) |
| Molecular Formula | C6H18O3Si3 |
| Molecular Weight | 222.462 |
| Flash Point | 26.4±18.8 °C |
| Exact Mass | 222.056366 |
| PSA | 27.69000 |
| LogP | 2.15520 |
| Vapour density | 1 (vs air) |
| Vapour Pressure | 11.6±0.2 mmHg at 25°C |
| Index of Refraction | 1.418 |
| InChIKey | HTDJPCNNEPUOOQ-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| Storage condition | Flammables area |
| Stability | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. Highly flammable. |
| Water Solubility | may decompose |
Safety Information
| Symbol | GHS02 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228 |
| Precautionary Statements | P210 |
| Hazard Codes | F:Flammable |
| Risk Phrases | R11;R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2931900001 |
Customs
| HS Code | 2931900001 |
|---|---|
| Summary | 2931900001 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。Lowest tariff:6.5%。General tariff:30.0% |
Articles2
More Articles| Environmental contaminants activate human and polar bear (Ursus maritimus) pregnane X receptors (PXR, NR1I2) differently. Toxicol. Appl. Pharmacol. 284(1) , 54-64, (2015) Many persistent organic pollutants (POPs) accumulate readily in polar bears because of their position as apex predators in Arctic food webs. The pregnane X receptor (PXR, formally NR1I2, here proposed... | |
| Effect of silicone on the collagen fibrillogenesis and stability. J. Pharm. Sci. 104(4) , 1275-81, (2015) Collagen, the most abundant protein in mammals, is able to form fibrils, which have central role in tissue repair, fibrosis, and tumor invasion. As a component of skin, tendons, and cartilages, this p... |
Synonyms
| hexamethylcyclortrisiloxane |
| HEXAMETHYLCYCLOHEXASILOXANE |
| EINECS 208-765-4 |
| SDK 10 |
| 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
| hexamethylcyclotrisiloxane |
| LS 8120 |
| cyclohexamethyltrisiloxane |
| Cyclotrisiloxane, 2,2,4,4,6,6-hexamethyl- |
| hexamethyl-cyclotrisiloxane |
| hexamethyl-cyclotrisiloxan |
| MFCD00005943 |
| 1,1,3,3,5,5-hexamethylcyclotrisiloxane |
| CYCLOTRISILOXANE |
| hexamethyltrisiloxane |
| Hexamethylcyclotrisi |
| cyclotrisiloxane,hexamethyl |
| CH7260 |
