Introduction：Basic information about CAS 913083-71-3|4-Chloro-2-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-2-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|
| CAS Number | 913083-71-3 | Molecular Weight | 318.75500 |
|---|
| Density | 1.304g/cm3 | Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.5ºC |
|---|
Names
| Name | 4-Chloro-2-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.304g/cm3 |
|---|
| Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClN2O3 |
|---|
| Molecular Weight | 318.75500 |
|---|
| Flash Point | 240.5ºC |
|---|
| Exact Mass | 318.07700 |
|---|
| PSA | 56.37000 |
|---|
| LogP | 3.90910 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | OQQMCJYMZWROIC-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(-c2cc3c(Cl)ccnc3[nH]2)cc(OC)c1OC |
|---|
