Introduction:Basic information about CAS 84901-45-1|Doliracetam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Doliracetam |
|---|
| CAS Number | 84901-45-1 | Molecular Weight | 266.29500 |
|---|
| Density | 1.276g/cm3 | Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.276g/cm3 |
|---|
| Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14N2O2 |
|---|
| Molecular Weight | 266.29500 |
|---|
| Flash Point | 285ºC |
|---|
| Exact Mass | 266.10600 |
|---|
| PSA | 63.40000 |
|---|
| LogP | 2.41570 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | MVZYGLQQNPFARE-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)CN1C(=O)C(c2ccccc2)c2ccccc21 |
|---|