Introduction：Basic information about CAS 156241-41-7|1,1,1,3,3,3-Hexafluoroisopropyl Trifluoromethanesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1,3,3,3-Hexafluoroisopropyl Trifluoromethanesulfonate |
|---|
| CAS Number | 156241-41-7 | Molecular Weight | 300.10000 |
|---|
| Density | 1.749g/cm3 | Boiling Point | 102.4ºC at 760 mmHg |
|---|
| Molecular Formula | C4HF9O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 15.7ºC |
|---|
Names
| Name | hexafluoroisopropyl trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.749g/cm3 |
|---|
| Boiling Point | 102.4ºC at 760 mmHg |
|---|
| Molecular Formula | C4HF9O3S |
|---|
| Molecular Weight | 300.10000 |
|---|
| Flash Point | 15.7ºC |
|---|
| Exact Mass | 299.95000 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.42660 |
|---|
| Vapour Pressure | 39.1mmHg at 25°C |
|---|
| Index of Refraction | 1.301 |
|---|
| InChIKey | NRHQWNHARTXNOE-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive;T: Toxic; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
Synonyms
| HEXAFLUOROIOSPROPYL TRIFLUOROMETHANESULFONATE |
| hexafluoroisopropyl trifluoromethanesulphonate |
| 1,1,1,3,3,3-hexafluoroisopropyl triflate |
| Trifluoromethanesulfonic Acid 1,1,1,3,3,3-Hexafluoroisopropyl Ester |
| 1,1,1,3,3,3-Hexafluoroisopropyltrifluoromethanesulphonate |
| 2H-Perfluoroprop-2-yl trifluoromethanesulphonate |
| 1,1,1,3,3,3-Hexafluoroisopropyl Triflate |
| 1,1,1,3,3,3-Hexafluoroisopropyl TrifluoroMethanesulfonate |
| 1,1,1,3,3,3-Hexafluoroisopropyl Trifluoromethanesulfonate |
| 1,1,1,3,3,3-Hexafluoroprop-2-yl trifluoromethanesulphonate,1,1,1,3,3,3-Hexafluoroprop-2-yl triflate |
