Introduction：Basic information about CAS 21121-62-0|2'-Chloro-6'-(diethylamino)-3'-methylfluoran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-Chloro-6'-(diethylamino)-3'-methylfluoran |
|---|
| CAS Number | 21121-62-0 | Molecular Weight | 419.90000 |
|---|
| Density | 1.35 g/cm3 | Boiling Point | 608.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H22ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 322ºC |
|---|
Names
| Name | 2'-chloro-6'-(dimethylamino)-3'-methylspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35 g/cm3 |
|---|
| Boiling Point | 608.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H22ClNO3 |
|---|
| Molecular Weight | 419.90000 |
|---|
| Flash Point | 322ºC |
|---|
| Exact Mass | 419.12900 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 6.06260 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | HUOKHAMXPNSWBJ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(C)c(Cl)cc1C21OC(=O)c2ccccc21 |
|---|
Synonyms
| 3-Diethylamino-6-methyl-7-chlorofluoran |
| 2'-Chloro-6'-(diethylamino)-3'-methylfluoran |
